![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | 050.jpg | 2019-10-04 07:26 | 4.4M | |
![[IMG]](/icons/image2.gif) | 4-PBS-Elements.png | 2019-09-20 09:40 | 371K | |
![[ ]](/icons/layout.gif) | 4 19 2016 FY2014 CGA Waiver Request.pdf | 2019-09-20 09:40 | 310K | |
![[DIR]](/icons/folder.gif) | 7kGardineDonation/ | 2019-09-20 09:00 | - | |
![[IMG]](/icons/image2.gif) | 8Z9A0169.JPG | 2019-09-20 09:40 | 384K | |
![[ ]](/icons/unknown.gif) | 8Z9A0169.JPG.old | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | 8Z9A0550.JPG | 2019-09-20 09:40 | 393K | |
![[ ]](/icons/unknown.gif) | 8Z9A0550.JPG.old | 2019-09-20 09:40 | 1.6M | |
![[ ]](/icons/unknown.gif) | 8Z9A9366.JPG.old | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | 8Z9A9366.jpg | 2019-09-20 09:40 | 392K | |
![[IMG]](/icons/image2.gif) | 8Z9A9390.JPG | 2019-09-20 09:40 | 503K | |
![[ ]](/icons/unknown.gif) | 8Z9A9390.JPG.old | 2019-09-20 09:40 | 1.6M | |
![[ ]](/icons/unknown.gif) | 8Z9A9836-1.jpg.old | 2019-09-20 09:40 | 359K | |
![[ ]](/icons/unknown.gif) | 8Z9A9836.jpg.old | 2019-09-20 09:40 | 359K | |
![[IMG]](/icons/image2.gif) | 20YearComplex.jpg | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | 20thcelebration2Complex.png | 2019-09-20 09:40 | 7.7M | |
![[ ]](/icons/layout.gif) | 340 Business Card.pdf | 2019-09-20 09:40 | 316K | |
![[IMG]](/icons/image2.gif) | 365.jpg | 2019-09-20 09:40 | 32K | |
![[IMG]](/icons/image2.gif) | 752.gif | 2019-09-29 12:32 | 17K | |
![[ ]](/icons/layout.gif) | 2016-2017 SY Public School Registration Schedule.pdf | 2019-09-20 09:40 | 571K | |
![[IMG]](/icons/image2.gif) | 2016-2017_Teacher_Effectiveness_Process(1)-1.png | 2019-09-20 09:40 | 1.3M | |
![[ ]](/icons/unknown.gif) | 2016-fs-sponsor-application.docx | 2019-09-20 09:40 | 843K | |
![[IMG]](/icons/image2.gif) | 2016 Literacy and Dyslexia Conference Flier.jpg | 2019-09-20 09:40 | 417K | |
![[IMG]](/icons/image2.gif) | 2016ReadingChallenge.jpg | 2019-09-20 09:40 | 457K | |
![[ ]](/icons/layout.gif) | 2016 USVI PTSA Annual Meeting Flyer & Registration Form.pdf | 2019-09-20 09:40 | 717K | |
![[DIR]](/icons/folder.gif) | 2017/ | 2019-09-26 19:12 | - | |
![[DIR]](/icons/folder.gif) | 2019/ | 2019-11-04 09:18 | - | |
![[IMG]](/icons/image2.gif) | 2019CAHSGradSlide-1.jpg | 2019-09-20 09:40 | 895K | |
![[IMG]](/icons/image2.gif) | 2019CAHSGradSlide.jpg | 2019-09-20 09:40 | 895K | |
![[IMG]](/icons/image2.gif) | 2019CentralGradSlide.jpg | 2019-09-20 09:40 | 936K | |
![[IMG]](/icons/image2.gif) | 2019ComplexGradSlide.jpg | 2019-09-20 09:40 | 1.0M | |
![[DIR]](/icons/folder.gif) | 2019 Crabbe-Stridiron/ | 2019-09-20 09:00 | - | |
![[IMG]](/icons/image2.gif) | 2019StateTeacheroftheYearKerraSamuelWithHer6thGradeStudents.JPG | 2019-09-20 09:40 | 1.9M | |
![[IMG]](/icons/image2.gif) | 15256_RS_Denim.jpg | 2019-09-20 09:40 | 4.3M | |
![[IMG]](/icons/image2.gif) | 20160503_095404.jpg | 2019-09-20 09:40 | 3.8M | |
![[IMG]](/icons/image2.gif) | 20160503_121621.jpg | 2019-09-20 09:40 | 4.1M | |
![[IMG]](/icons/image2.gif) | 20160504_120544.jpg | 2019-09-20 09:40 | 3.5M | |
![[IMG]](/icons/image2.gif) | 20190327_195526.jpg | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | AARJHAwardDinnerBanquet.jpg | 2019-09-20 09:40 | 336K | |
![[DIR]](/icons/folder.gif) | AARJHS Art Honor Society/ | 2019-09-20 09:00 | - | |
![[IMG]](/icons/image2.gif) | ACJHS Phoenix Soccer Team and coaches.JPG | 2019-09-20 09:40 | 158K | |
![[IMG]](/icons/image2.gif) | ActingDeputySuperintendentDr.CarlaBastian,ElementaryProgramsWOYCCoordinatorJeselleCruse-Peters,GovernorAlbertBryan,Jr.,andSumayahBryanwithaLewMucklestudents.JPG | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | AddieCYR.jpg | 2019-09-20 09:40 | 906K | |
![[IMG]](/icons/image2.gif) | Akil Prince2- Rivera School - Intermediate winners.jpg | 2019-09-20 09:40 | 138K | |
![[IMG]](/icons/image2.gif) | AllTogether.jpg | 2019-09-20 09:40 | 783K | |
![[IMG]](/icons/image2.gif) | AllintheReel.jpg | 2019-09-20 09:40 | 506K | |
![[IMG]](/icons/image2.gif) | Alvincent3.jpg | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | AlvincentReads.jpg | 2019-09-20 09:40 | 442K | |
![[IMG]](/icons/image2.gif) | AlvincentReads2.jpg | 2019-09-20 09:40 | 396K | |
![[IMG]](/icons/image2.gif) | American Samoa Reps - Coffin & Sene.jpg | 2019-09-20 09:40 | 128K | |
![[IMG]](/icons/image2.gif) | Andrews Intermediate winner Jared Brown - Popcorn.jpg | 2019-09-20 09:40 | 134K | |
![[IMG]](/icons/image2.gif) | AnitaThomasKG-1stPlace-BestPresentation.JPG | 2019-09-20 09:40 | 1.3M | |
![[IMG]](/icons/image2.gif) | Antilles Brainstorms.jpg | 2019-09-20 09:40 | 2.3M | |
![[IMG]](/icons/image2.gif) | AntillesSchoolMATHCOUNTS.JPG | 2019-09-20 09:40 | 3.0M | |
![[ ]](/icons/unknown.gif) | Arthur1.JPG.old | 2019-09-20 09:40 | 4.8M | |
![[IMG]](/icons/image2.gif) | Arthur1.jpg | 2019-09-20 09:40 | 242K | |
![[IMG]](/icons/image2.gif) | Arthur2.JPG | 2019-09-20 09:40 | 371K | |
![[ ]](/icons/unknown.gif) | Arthur2.JPG.old | 2019-09-20 09:40 | 6.1M | |
![[IMG]](/icons/image2.gif) | Asta Williams @ Gardine.jpg | 2019-09-20 09:40 | 940K | |
![[IMG]](/icons/image2.gif) | Audience.jpg | 2019-09-20 09:40 | 141K | |
![[IMG]](/icons/image2.gif) | BCB 1.JPG | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | BCB2.JPG | 2019-09-20 09:40 | 3.1M | |
![[IMG]](/icons/image2.gif) | BCB3.JPG | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | BCB4.JPG | 2019-09-20 09:40 | 5.7M | |
![[IMG]](/icons/image2.gif) | BCB Celebrates 110th Bday.jpg | 2019-09-20 09:40 | 281K | |
![[IMG]](/icons/image2.gif) | BCBMiddleSchool.JPG | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | BackgroundChecks.png | 2019-09-20 09:40 | 21K | |
![[IMG]](/icons/image2.gif) | Barra Integrity.JPG | 2019-09-20 09:40 | 207K | |
![[IMG]](/icons/image2.gif) | Battle of the Agencies Highlights.jpg | 2019-09-20 09:40 | 5.7M | |
![[IMG]](/icons/image2.gif) | Belle.jpg | 2019-09-20 09:40 | 15M | |
![[IMG]](/icons/image2.gif) | BlackHistoryBizSTTJ.jpg | 2019-09-20 09:40 | 305K | |
![[IMG]](/icons/image2.gif) | BlkHstry2.jpg | 2019-09-20 09:40 | 314K | |
![[IMG]](/icons/image2.gif) | Blue.jpg | 2019-09-20 09:40 | 18K | |
![[IMG]](/icons/image2.gif) | Booksign.jpg | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | Bowling - Hackers Logo - Back.png | 2019-09-20 09:40 | 175K | |
![[IMG]](/icons/image2.gif) | Browne2ManUp.jpg | 2019-09-20 09:40 | 93K | |
![[IMG]](/icons/image2.gif) | BrowneManUp.jpg | 2019-09-20 09:40 | 52K | |
![[IMG]](/icons/image2.gif) | Bryson on storytelling.jpg | 2019-09-20 09:40 | 134K | |
![[IMG]](/icons/image2.gif) | Burnett awards 2nd Second Honor Student Battiste.jpg | 2019-09-20 09:40 | 126K | |
![[IMG]](/icons/image2.gif) | CAHSCancrynandLockhart-1.jpg | 2019-09-20 09:40 | 298K | |
![[IMG]](/icons/image2.gif) | CAHSCancrynandLockhart.jpg | 2019-09-20 09:40 | 298K | |
![[IMG]](/icons/image2.gif) | CAHS Queen 2016.jpg | 2019-09-20 09:40 | 17M | |
![[DIR]](/icons/folder.gif) | CAM-Web/ | 2019-10-21 11:22 | - | |
![[IMG]](/icons/image2.gif) | CEC 2.jpg | 2019-09-20 09:40 | 66K | |
![[IMG]](/icons/image2.gif) | CHS1.jpg | 2019-09-20 09:40 | 2.2M | |
![[IMG]](/icons/image2.gif) | CHS2.jpg | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | CHS4.jpg | 2019-09-20 09:40 | 2.4M | |
![[IMG]](/icons/image2.gif) | CHS 2016.jpg | 2019-09-20 09:40 | 4.5M | |
![[IMG]](/icons/image2.gif) | CHS Family fun day.jpg | 2019-09-20 09:40 | 117K | |
![[IMG]](/icons/image2.gif) | CHS Quadrille Dancers form circle.JPG | 2019-09-20 09:40 | 149K | |
![[IMG]](/icons/image2.gif) | CHSatMapp.JPG | 2019-09-20 09:40 | 1.9M | |
![[IMG]](/icons/image2.gif) | COSTARICANEW.jpg | 2019-09-20 09:40 | 115K | |
![[IMG]](/icons/image2.gif) | CTEC_Tourism-1.jpg | 2019-09-20 09:40 | 485K | |
![[IMG]](/icons/image2.gif) | CTEC_Tourism.jpg | 2019-09-20 09:40 | 485K | |
![[IMG]](/icons/image2.gif) | CTESTTJ.JPG | 2019-09-20 09:40 | 3.0M | |
![[IMG]](/icons/image2.gif) | CTEguest.JPG | 2019-09-20 09:40 | 2.2M | |
![[IMG]](/icons/image2.gif) | CYRPstrFinal.jpg | 2019-09-20 09:40 | 769K | |
![[IMG]](/icons/image2.gif) | CYRWebsite.jpg | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | CancrynSpring2016.jpg | 2019-09-20 09:40 | 604K | |
![[ ]](/icons/layout.gif) | Career Development Manager (JA) (002).pdf | 2019-09-20 09:40 | 30K | |
![[IMG]](/icons/image2.gif) | CertificateSlide.jpg | 2019-09-20 09:40 | 1.4M | |
![[IMG]](/icons/image2.gif) | Cherie Munchez.jpg | 2019-09-20 09:40 | 109K | |
![[IMG]](/icons/image2.gif) | Chess1.JPG | 2019-09-20 09:40 | 146K | |
![[IMG]](/icons/image2.gif) | Chess1A.JPG | 2019-09-20 09:40 | 133K | |
![[IMG]](/icons/image2.gif) | Chess2.JPG | 2019-09-20 09:40 | 138K | |
![[IMG]](/icons/image2.gif) | Chess3.JPG | 2019-09-20 09:40 | 131K | |
![[IMG]](/icons/image2.gif) | Christmas 2016.jpg | 2019-09-20 09:40 | 487K | |
![[IMG]](/icons/image2.gif) | Chrome-RefreshKey.png | 2019-09-20 09:40 | 18K | |
![[IMG]](/icons/image2.gif) | ClaytonSlide.jpg | 2019-09-20 09:40 | 878K | |
![[IMG]](/icons/image2.gif) | CleanSTXBins.JPG | 2019-09-20 09:40 | 167K | |
![[IMG]](/icons/image2.gif) | Clean up.jpg | 2019-09-20 09:40 | 725K | |
![[IMG]](/icons/image2.gif) | ClosedBuildingB.JPG | 2019-09-20 09:40 | 122K | |
![[SND]](/icons/sound2.gif) | Cobblestoneandbricks.mp3 | 2019-09-20 09:40 | 418K | |
![[IMG]](/icons/image2.gif) | ComingSoonCrest.jpg | 2019-09-20 09:40 | 2.9K | |
![[IMG]](/icons/image2.gif) | ComingSoonCrest3.jpg | 2019-09-20 09:40 | 2.9K | |
![[IMG]](/icons/image2.gif) | Comingsoon.png | 2019-09-20 09:40 | 44K | |
![[IMG]](/icons/image2.gif) | Comingsoon2.jpg | 2019-09-20 09:40 | 20K | |
![[IMG]](/icons/image2.gif) | CommNewYears.jpg | 2019-09-20 09:40 | 162K | |
![[IMG]](/icons/image2.gif) | CommNewYears.png | 2019-09-20 09:40 | 400K | |
![[IMG]](/icons/image2.gif) | CommishSpeaks.jpg | 2019-09-20 09:40 | 3.0M | |
![[IMG]](/icons/image2.gif) | Complex2016.jpg | 2019-09-20 09:40 | 8.7M | |
![[IMG]](/icons/image2.gif) | Conferences STTJ .jpg | 2019-09-20 09:40 | 910K | |
![[IMG]](/icons/image2.gif) | Corridor_Video3.png | 2019-09-20 09:40 | 182K | |
![[IMG]](/icons/image2.gif) | Countdown round winner congratulated.jpg | 2019-09-20 09:40 | 125K | |
![[IMG]](/icons/image2.gif) | CrucianHousTours.jpg | 2019-09-20 09:40 | 115K | |
![[IMG]](/icons/image2.gif) | Cruise_Ship.jpg | 2019-09-20 09:40 | 43K | |
![[IMG]](/icons/image2.gif) | DCTrip.jpg | 2019-09-20 09:40 | 247K | |
![[IMG]](/icons/image2.gif) | DCTrip2.jpeg | 2019-09-20 09:40 | 1.1M | |
![[IMG]](/icons/image2.gif) | DCTripExhibitH.jpeg | 2019-09-20 09:40 | 1.1M | |
![[IMG]](/icons/image2.gif) | DCTripWM_VI.jpg | 2019-09-20 09:40 | 4.5M | |
![[IMG]](/icons/image2.gif) | DCTripimage(12).jpeg | 2019-09-20 09:40 | 904K | |
![[IMG]](/icons/image2.gif) | DIRECTOR DONADELLE -IEKHS MAROON MEN.jpg | 2019-09-20 09:40 | 104K | |
![[ ]](/icons/unknown.gif) | DOE - Book Swaps Featured at STX Summer Schools.docx | 2019-09-20 09:40 | 1.4M | |
![[IMG]](/icons/image2.gif) | DSC_0230-min.JPG | 2019-09-20 09:40 | 737K | |
![[IMG]](/icons/image2.gif) | DSC_0363.JPG | 2019-09-20 09:40 | 672K | |
![[IMG]](/icons/image2.gif) | Dance2.JPG | 2019-09-20 09:40 | 3.8M | |
![[IMG]](/icons/image2.gif) | Dance3.JPG | 2019-09-20 09:40 | 5.2M | |
![[IMG]](/icons/image2.gif) | Dance4.JPG | 2019-09-20 09:40 | 3.6M | |
![[IMG]](/icons/image2.gif) | Dance5.JPG | 2019-09-20 09:40 | 4.7M | |
![[IMG]](/icons/image2.gif) | Dance6.JPG | 2019-09-20 09:40 | 3.7M | |
![[IMG]](/icons/image2.gif) | Dance7.JPG | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | Dance8.JPG | 2019-09-20 09:40 | 4.8M | |
![[IMG]](/icons/image2.gif) | Dance9.JPG | 2019-09-20 09:40 | 4.9M | |
![[IMG]](/icons/image2.gif) | Dance10.JPG | 2019-09-20 09:40 | 3.5M | |
![[IMG]](/icons/image2.gif) | Dance11.JPG | 2019-09-20 09:40 | 5.2M | |
![[IMG]](/icons/image2.gif) | Dance12.JPG | 2019-09-20 09:40 | 3.7M | |
![[IMG]](/icons/image2.gif) | Dance13.JPG | 2019-09-20 09:40 | 5.6M | |
![[IMG]](/icons/image2.gif) | Dance14.JPG | 2019-09-20 09:40 | 4.9M | |
![[IMG]](/icons/image2.gif) | Dance15.JPG | 2019-09-20 09:40 | 4.8M | |
![[IMG]](/icons/image2.gif) | DanceYes1.JPG | 2019-09-20 09:40 | 3.4M | |
![[IMG]](/icons/image2.gif) | DancingClassrooms (2).jpg | 2019-09-20 09:40 | 249K | |
![[IMG]](/icons/image2.gif) | DancingClassroomss.jpg | 2019-09-20 09:40 | 249K | |
![[IMG]](/icons/image2.gif) | De Chabert congrats.JPG | 2019-09-20 09:40 | 180K | |
![[IMG]](/icons/image2.gif) | Delivering an important message to students.jpg | 2019-09-20 09:40 | 134K | |
![[IMG]](/icons/image2.gif) | Denise Gomes.jpg | 2019-09-20 09:40 | 93K | |
![[IMG]](/icons/image2.gif) | Dober1BlkHstry.jpg | 2019-09-20 09:40 | 68K | |
![[IMG]](/icons/image2.gif) | DoberElem.jpg | 2019-09-20 09:40 | 58K | |
![[IMG]](/icons/image2.gif) | DoberMakerspace3.JPG | 2019-09-20 09:40 | 133K | |
![[ ]](/icons/layout.gif) | Document Request Form.pdf | 2019-09-20 09:40 | 249K | |
![[ ]](/icons/layout.gif) | Donor Request Form - Office of Special Funding.pdf | 2019-09-20 09:40 | 287K | |
![[ ]](/icons/layout.gif) | Drug Prevention Specialist.pdf | 2019-09-20 09:40 | 39K | |
![[IMG]](/icons/image2.gif) | Dwydale & Kevin.jpg | 2019-09-20 09:40 | 190K | |
![[IMG]](/icons/image2.gif) | Dwydale, Kevin & Danica.jpg | 2019-09-20 09:40 | 178K | |
![[IMG]](/icons/image2.gif) | EBO Photo 1.jpg | 2019-09-20 09:40 | 3.1M | |
![[IMG]](/icons/image2.gif) | EBO Photo 2.jpg | 2019-09-20 09:40 | 2.6M | |
![[IMG]](/icons/image2.gif) | EBO Photo 3.jpg | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | EBO Photo 4.jpg | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | EBO Photo 5.jpg | 2019-09-20 09:40 | 2.6M | |
![[IMG]](/icons/image2.gif) | ECJH students listen to remarks from guest speaker.jpg | 2019-09-20 09:40 | 148K | |
![[IMG]](/icons/image2.gif) | EasterMssg.jpg | 2019-09-20 09:40 | 467K | |
![[IMG]](/icons/image2.gif) | Education Press Conference.jpg | 2019-09-20 09:40 | 85K | |
![[IMG]](/icons/image2.gif) | ElenaAvid.jpg | 2019-09-20 09:40 | 276K | |
![[IMG]](/icons/image2.gif) | ElenaTest.jpg | 2019-09-20 09:40 | 153K | |
![[IMG]](/icons/image2.gif) | EmileGov.JPG | 2019-09-20 09:40 | 1.8M | |
![[IMG]](/icons/image2.gif) | Emmanuella Perez-Cassius2.JPG | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | Employee.jpg | 2019-09-20 09:40 | 799K | |
![[IMG]](/icons/image2.gif) | Employee of Yr Beverly Gittens.jpg | 2019-09-20 09:40 | 135K | |
![[IMG]](/icons/image2.gif) | EmpressTries.jpg | 2019-09-20 09:40 | 3.0M | |
![[IMG]](/icons/image2.gif) | Erica Hansen directs CHS Quadrille Dancers.JPG | 2019-09-20 09:40 | 222K | |
![[IMG]](/icons/image2.gif) | EulalieReads.jpg | 2019-09-20 09:40 | 113K | |
![[IMG]](/icons/image2.gif) | ExpoSTX2016.jpg | 2019-09-20 09:40 | 563K | |
![[IMG]](/icons/image2.gif) | FACEBOOKNEW-2.jpg | 2019-09-20 09:40 | 4.0M | |
![[IMG]](/icons/image2.gif) | FAM3.20Policy.png | 2019-09-20 09:40 | 277K | |
![[IMG]](/icons/image2.gif) | FARMMOVIENIGHT.jpg | 2019-09-20 09:40 | 408K | |
![[IMG]](/icons/image2.gif) | FZ4A5150.jpg | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | FZ4A5165.jpg | 2019-09-20 09:40 | 2.6M | |
![[IMG]](/icons/image2.gif) | FZ4A5216.jpg | 2019-09-20 09:40 | 2.6M | |
![[IMG]](/icons/image2.gif) | FZ4A5243.jpg | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | FZ4A5293.jpg | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | FZ4A5324.jpg | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | FZ4A5355.jpg | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | FZ4A5377.jpg | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | FZ4A5390.jpg | 2019-09-20 09:40 | 3.1M | |
![[IMG]](/icons/image2.gif) | FZ4A5432.jpg | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | FZ4A5446.jpg | 2019-09-20 09:40 | 2.7M | |
![[IMG]](/icons/image2.gif) | FZ4A5452.jpg | 2019-09-20 09:40 | 2.7M | |
![[IMG]](/icons/image2.gif) | FZ4A5474.jpg | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | FZ4A5482.jpg | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | FZ4A5497.jpg | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | FZ4A5529.jpg | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | FZ4A5668.jpg | 2019-09-20 09:40 | 2.2M | |
![[IMG]](/icons/image2.gif) | FZ4A5686.jpg | 2019-09-20 09:40 | 2.0M | |
![[IMG]](/icons/image2.gif) | FZ4A5700.jpg | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | FZ4A5736.jpg | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | FZ4A5745.jpg | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | FZ4A5750.jpg | 2019-09-20 09:40 | 2.7M | |
![[IMG]](/icons/image2.gif) | FZ4A5752.jpg | 2019-09-20 09:40 | 2.6M | |
![[IMG]](/icons/image2.gif) | FZ4A5753.jpg | 2019-09-20 09:40 | 2.1M | |
![[IMG]](/icons/image2.gif) | FZ4A5788.jpg | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | FZ4A5791.jpg | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | FZ4A5811.jpg | 2019-09-20 09:40 | 2.7M | |
![[IMG]](/icons/image2.gif) | FZ4A5812.jpg | 2019-09-20 09:40 | 4.5M | |
![[IMG]](/icons/image2.gif) | FZ4A5840.jpg | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | FZ4A5860.jpg | 2019-09-20 09:40 | 2.1M | |
![[IMG]](/icons/image2.gif) | FZ4A5971.jpg | 2019-09-20 09:40 | 2.4M | |
![[IMG]](/icons/image2.gif) | FZ4A5994.jpg | 2019-09-20 09:40 | 2.4M | |
![[IMG]](/icons/image2.gif) | FZ4A9345.jpg | 2019-09-20 09:40 | 2.1M | |
![[IMG]](/icons/image2.gif) | FZ4A9617.jpg | 2019-09-20 09:40 | 3.1M | |
![[IMG]](/icons/image2.gif) | FashionEASTERSTXposter.jpg | 2019-09-20 09:40 | 220K | |
![[IMG]](/icons/image2.gif) | FashionEasterSttPoster.jpg | 2019-09-20 09:40 | 831K | |
![[IMG]](/icons/image2.gif) | Father’sDaySlide.jpg | 2019-09-20 09:40 | 1.0M | |
![[IMG]](/icons/image2.gif) | FathersDaySlide.jpg | 2019-09-20 09:40 | 1.0M | |
![[IMG]](/icons/image2.gif) | FederalGrantsBanner2.jpg | 2019-09-20 09:40 | 56K | |
![[IMG]](/icons/image2.gif) | FederalGrantsDirectory.png | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | FederalGrantsProgramListing.png | 2019-09-20 09:40 | 3.0M | |
![[IMG]](/icons/image2.gif) | Federalgrantsbanner.jpg | 2019-09-20 09:40 | 100K | |
![[IMG]](/icons/image2.gif) | Firemen pose with Gardine School Primary Student at WOYC Career Day Wednesday.jpg | 2019-09-20 09:40 | 130K | |
![[ ]](/icons/layout.gif) | Fixed Asset Analyst_JA.pdf | 2019-09-20 09:40 | 32K | |
![[IMG]](/icons/image2.gif) | ForGirlsOnly Cancryn.JPG | 2019-09-20 09:40 | 4.2M | |
![[IMG]](/icons/image2.gif) | ForGirlsOnlyCancryn2.JPG | 2019-09-20 09:40 | 3.5M | |
![[IMG]](/icons/image2.gif) | ForGirlsOnlyKean.JPG | 2019-09-20 09:40 | 3.8M | |
![[IMG]](/icons/image2.gif) | FraudSlide-1.jpg | 2019-09-20 09:40 | 359K | |
![[IMG]](/icons/image2.gif) | FraudSlide-2.jpg | 2019-09-20 09:40 | 710K | |
![[IMG]](/icons/image2.gif) | FraudSlide.jpg | 2019-09-20 09:40 | 359K | |
![[IMG]](/icons/image2.gif) | Freedom1.jpg | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | Freedom2.jpg | 2019-09-20 09:40 | 1.9M | |
![[IMG]](/icons/image2.gif) | Freedom3.jpg | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | Freedom School students huddle to hear a good story.jpg | 2019-09-20 09:40 | 129K | |
![[IMG]](/icons/image2.gif) | Friends @ TGISUNDAY.JPG | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | FtChrs1.jpg | 2019-09-20 09:40 | 160K | |
![[IMG]](/icons/image2.gif) | FtChrst2.jpg | 2019-09-20 09:40 | 239K | |
![[IMG]](/icons/image2.gif) | FtChrst3.jpg | 2019-09-20 09:40 | 174K | |
![[IMG]](/icons/image2.gif) | FullSizeR.jpg | 2019-09-20 09:40 | 29K | |
![[IMG]](/icons/image2.gif) | FullSizeRender.jpg | 2019-09-20 09:40 | 1.2M | |
![[ ]](/icons/layout.gif) | GM 1.1_Development of Grant Application.pdf | 2019-09-20 09:40 | 369K | |
![[ ]](/icons/layout.gif) | GM 1.2_Creating The New Grant and Program GL Codes in MUNIS.pdf | 2019-09-20 09:40 | 400K | |
![[IMG]](/icons/image2.gif) | Gabriel Lewis - primary winner -parents - congresswoman-principal.jpg | 2019-09-20 09:40 | 167K | |
![[IMG]](/icons/image2.gif) | GardenClubGladys.jpg | 2019-09-20 09:40 | 90K | |
![[IMG]](/icons/image2.gif) | GardineGittens.jpg | 2019-09-20 09:40 | 176K | |
![[IMG]](/icons/image2.gif) | GirlsChampionship2019slide-1.jpg | 2019-09-20 09:40 | 844K | |
![[IMG]](/icons/image2.gif) | GirlsChampionship2019slide.jpg | 2019-09-20 09:40 | 844K | |
![[IMG]](/icons/image2.gif) | GladysSpringConcert2016.jpg | 2019-09-20 09:40 | 374K | |
![[ ]](/icons/layout.gif) | GlitzFlyer.pdf | 2019-09-20 09:40 | 314K | |
![[ ]](/icons/layout.gif) | GlitzFlyer1.pdf | 2019-09-20 09:40 | 314K | |
![[IMG]](/icons/image2.gif) | GoRed.JPG | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | GoRed2.JPG | 2019-09-20 09:40 | 375K | |
![[IMG]](/icons/image2.gif) | GoRed3.JPG | 2019-09-20 09:40 | 121K | |
![[IMG]](/icons/image2.gif) | Gomes Addresses2.jpg | 2019-09-20 09:40 | 518K | |
![[IMG]](/icons/image2.gif) | Gomes reads 2.jpg | 2019-09-20 09:40 | 118K | |
![[IMG]](/icons/image2.gif) | GriffithSmiles.jpg | 2019-09-20 09:40 | 3.6M | |
![[IMG]](/icons/image2.gif) | Group room.png | 2019-09-20 09:40 | 625K | |
![[IMG]](/icons/image2.gif) | Guam Delegation-Woodward, Borja & Higa.jpg | 2019-09-20 09:40 | 87K | |
![[IMG]](/icons/image2.gif) | Guest Speaker Christian2.jpg | 2019-09-20 09:40 | 883K | |
![[IMG]](/icons/image2.gif) | Guests carefully record the steel pan action.jpg | 2019-09-20 09:40 | 149K | |
![[IMG]](/icons/image2.gif) | Guests stare at Steel Pans.jpg | 2019-09-20 09:40 | 134K | |
![[ ]](/icons/layout.gif) | HISPANIC HERITAGE MONTH ESSAY COMPETITION.pdf | 2019-09-20 09:40 | 203K | |
![[IMG]](/icons/image2.gif) | HRClosed.jpg | 2019-09-20 09:40 | 722K | |
![[ ]](/icons/layout.gif) | HR_Employee_Handbook.pdf | 2019-09-20 09:40 | 2.0M | |
![[IMG]](/icons/image2.gif) | HallCYR.jpg | 2019-09-20 09:40 | 920K | |
![[IMG]](/icons/image2.gif) | HallManUp.jpg | 2019-09-20 09:40 | 102K | |
![[ ]](/icons/layout.gif) | HallPass2.pdf | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | HallPass3.jpg | 2019-09-20 09:40 | 171K | |
![[IMG]](/icons/image2.gif) | HallPassCultEd.jpg | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | Hands of Appreciation2.jpg | 2019-09-20 09:40 | 151K | |
![[IMG]](/icons/image2.gif) | HandsofAppreciation2.jpg | 2019-09-20 09:40 | 151K | |
![[IMG]](/icons/image2.gif) | Harambee begins.jpg | 2019-09-20 09:40 | 140K | |
![[IMG]](/icons/image2.gif) | Hassel and Kg students.jpg | 2019-09-20 09:40 | 125K | |
![[IMG]](/icons/image2.gif) | Henderson1.jpg | 2019-09-20 09:40 | 829K | |
![[IMG]](/icons/image2.gif) | Henderson4.jpg | 2019-09-20 09:40 | 736K | |
![[IMG]](/icons/image2.gif) | Henderson5.jpg | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | Henderson6.jpg | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | Henderson7.jpg | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | HendersonFire.jpg | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | HendersonJumbie.jpg | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | HighlightTabs-1.jpg | 2019-09-20 09:40 | 46K | |
![[IMG]](/icons/image2.gif) | HighlightTabs2-1.jpg | 2019-09-20 09:40 | 80K | |
![[IMG]](/icons/image2.gif) | HighlightTabs3-1.jpg | 2019-09-20 09:40 | 35K | |
![[IMG]](/icons/image2.gif) | HighlightTabs3-2.jpg | 2019-09-20 09:40 | 35K | |
![[IMG]](/icons/image2.gif) | HispanicHeritage.jpg | 2019-09-20 09:40 | 634K | |
![[IMG]](/icons/image2.gif) | HispanicHeritage3.jpg | 2019-09-20 09:40 | 560K | |
![[IMG]](/icons/image2.gif) | Honoree Jahmoya Gussie.jpg | 2019-09-20 09:40 | 149K | |
![[IMG]](/icons/image2.gif) | Honorees Stand.jpg | 2019-09-20 09:40 | 147K | |
![[IMG]](/icons/image2.gif) | Huggins.jpg | 2019-09-20 09:40 | 1.4M | |
![[IMG]](/icons/image2.gif) | IEKHS DYANAMITES FINEST with DIRECTOR NICOLE SYMS.jpg | 2019-09-20 09:40 | 209K | |
![[IMG]](/icons/image2.gif) | IEKHS GROUP PHOTO.JPG | 2019-09-20 09:40 | 720K | |
![[IMG]](/icons/image2.gif) | IEKHS JENIA AUGUSTINE, AMINISHA BAILEY, AKIMO DAWSON, DEH'SHANIECE COLON, DINEIJAH ATTIDORE-CHARLES, SHERWIN WILLIAMS.jpg | 2019-09-20 09:40 | 168K | |
![[IMG]](/icons/image2.gif) | IMG-1222.JPG | 2019-09-20 09:40 | 318K | |
![[IMG]](/icons/image2.gif) | IMG-1225.JPG | 2019-09-20 09:40 | 76K | |
![[IMG]](/icons/image2.gif) | IMG-1226.JPG | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | IMG_0034.JPG | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | IMG_0497.JPG | 2019-09-20 09:40 | 1.1M | |
![[IMG]](/icons/image2.gif) | IMG_0728(2)2.jpg | 2019-09-20 09:40 | 3.5M | |
![[IMG]](/icons/image2.gif) | IMG_0765[1].JPG | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | IMG_0766.jpg | 2019-09-20 09:40 | 2.3M | |
![[IMG]](/icons/image2.gif) | IMG_0788[1].JPG | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | IMG_0830[1].JPG | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | IMG_0844.JPG | 2019-09-20 09:40 | 1.9M | |
![[IMG]](/icons/image2.gif) | IMG_0866.JPG | 2019-09-20 09:40 | 1.6M | |
![[IMG]](/icons/image2.gif) | IMG_0980.JPG | 2019-09-20 09:40 | 1.8M | |
![[IMG]](/icons/image2.gif) | IMG_1062.JPG | 2019-09-20 09:40 | 8.4M | |
![[IMG]](/icons/image2.gif) | IMG_1077.JPG | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | IMG_1091.JPG | 2019-09-20 09:40 | 2.7M | |
![[IMG]](/icons/image2.gif) | IMG_1108.JPG | 2019-09-20 09:40 | 3.0M | |
![[IMG]](/icons/image2.gif) | IMG_1125.JPG | 2019-09-20 09:40 | 4.2M | |
![[IMG]](/icons/image2.gif) | IMG_1126.JPG | 2019-09-20 09:40 | 4.0M | |
![[IMG]](/icons/image2.gif) | IMG_1129.JPG | 2019-09-20 09:40 | 3.7M | |
![[IMG]](/icons/image2.gif) | IMG_1130.JPG | 2019-09-20 09:40 | 4.2M | |
![[IMG]](/icons/image2.gif) | IMG_1136.JPG | 2019-09-20 09:40 | 3.8M | |
![[IMG]](/icons/image2.gif) | IMG_1141[1].JPG | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | IMG_1150.jpg | 2019-09-20 09:40 | 2.6M | |
![[IMG]](/icons/image2.gif) | IMG_1151.jpg | 2019-09-20 09:40 | 2.4M | |
![[IMG]](/icons/image2.gif) | IMG_1152.jpg | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | IMG_1165[1].JPG | 2019-09-20 09:40 | 4.3M | |
![[IMG]](/icons/image2.gif) | IMG_1183[1].JPG | 2019-09-20 09:40 | 4.4M | |
![[IMG]](/icons/image2.gif) | IMG_1190.1.jpg | 2019-09-20 09:40 | 971K | |
![[IMG]](/icons/image2.gif) | IMG_1206[1].JPG | 2019-09-20 09:40 | 4.3M | |
![[IMG]](/icons/image2.gif) | IMG_1292.JPG | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | IMG_1292_1366x768.JPG | 2019-09-20 09:40 | 71K | |
![[IMG]](/icons/image2.gif) | IMG_1313.JPG | 2019-09-20 09:40 | 1.6M | |
![[IMG]](/icons/image2.gif) | IMG_1334.JPG | 2019-09-20 09:40 | 1.6M | |
![[IMG]](/icons/image2.gif) | IMG_1334_1366x768.JPG | 2019-09-20 09:40 | 77K | |
![[IMG]](/icons/image2.gif) | IMG_1344.JPG | 2019-09-20 09:40 | 2.0M | |
![[IMG]](/icons/image2.gif) | IMG_1344_1366x768.JPG | 2019-09-20 09:40 | 131K | |
![[IMG]](/icons/image2.gif) | IMG_1350.JPG | 2019-09-20 09:40 | 1.4M | |
![[IMG]](/icons/image2.gif) | IMG_1350_1366x768.JPG | 2019-09-20 09:40 | 78K | |
![[IMG]](/icons/image2.gif) | IMG_1362.JPG | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | IMG_1362_1366x768.JPG | 2019-09-20 09:40 | 109K | |
![[IMG]](/icons/image2.gif) | IMG_1367.JPG | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | IMG_1367_1366x768.JPG | 2019-09-20 09:40 | 106K | |
![[IMG]](/icons/image2.gif) | IMG_1384(2).JPG | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | IMG_1400.jpg | 2019-09-20 09:40 | 161K | |
![[IMG]](/icons/image2.gif) | IMG_1402.jpg | 2019-09-20 09:40 | 165K | |
![[IMG]](/icons/image2.gif) | IMG_1403.jpg | 2019-09-20 09:40 | 169K | |
![[IMG]](/icons/image2.gif) | IMG_1417.JPG | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | IMG_1498.JPG | 2019-09-20 09:40 | 116K | |
![[IMG]](/icons/image2.gif) | IMG_1521.JPG | 2019-09-20 09:40 | 788K | |
![[IMG]](/icons/image2.gif) | IMG_1585.JPG | 2019-09-20 09:40 | 3.0M | |
![[IMG]](/icons/image2.gif) | IMG_1593.JPG | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | IMG_1600.JPG | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | IMG_1603.JPG | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | IMG_1611.JPG | 2019-09-20 09:40 | 2.7M | |
![[IMG]](/icons/image2.gif) | IMG_1638.JPG | 2019-09-20 09:40 | 3.4M | |
![[IMG]](/icons/image2.gif) | IMG_1641.JPG | 2019-09-20 09:40 | 2.6M | |
![[IMG]](/icons/image2.gif) | IMG_1646.JPG | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | IMG_1650.JPG | 2019-09-20 09:40 | 3.4M | |
![[IMG]](/icons/image2.gif) | IMG_1654.JPG | 2019-09-20 09:40 | 3.1M | |
![[IMG]](/icons/image2.gif) | IMG_1677.JPG | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | IMG_1686.JPG | 2019-09-20 09:40 | 2.6M | |
![[IMG]](/icons/image2.gif) | IMG_1693.JPG | 2019-09-20 09:40 | 2.6M | |
![[IMG]](/icons/image2.gif) | IMG_1708.JPG | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | IMG_1723.JPG | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | IMG_1783.JPG | 2019-09-20 09:40 | 764K | |
![[IMG]](/icons/image2.gif) | IMG_1793.JPG | 2019-09-20 09:40 | 1.1M | |
![[IMG]](/icons/image2.gif) | IMG_2457.JPG | 2019-09-20 09:40 | 400K | |
![[IMG]](/icons/image2.gif) | IMG_2460.JPG | 2019-09-20 09:40 | 281K | |
![[IMG]](/icons/image2.gif) | IMG_2460_1366x768.JPG | 2019-09-20 09:40 | 76K | |
![[IMG]](/icons/image2.gif) | IMG_2479(1).JPG | 2019-09-20 09:40 | 352K | |
![[IMG]](/icons/image2.gif) | IMG_2479(2)-1.JPG | 2019-09-20 09:40 | 172K | |
![[IMG]](/icons/image2.gif) | IMG_2479(2).JPG | 2019-09-20 09:40 | 172K | |
![[IMG]](/icons/image2.gif) | IMG_2634-1.jpeg | 2019-09-20 09:40 | 304K | |
![[IMG]](/icons/image2.gif) | IMG_2634.jpeg | 2019-09-20 09:40 | 304K | |
![[IMG]](/icons/image2.gif) | IMG_3146.JPG | 2019-09-20 09:40 | 94K | |
![[IMG]](/icons/image2.gif) | IMG_3147.JPG | 2019-09-20 09:40 | 100K | |
![[IMG]](/icons/image2.gif) | IMG_3150.JPG | 2019-09-20 09:40 | 97K | |
![[IMG]](/icons/image2.gif) | IMG_3151.JPG | 2019-09-20 09:40 | 102K | |
![[IMG]](/icons/image2.gif) | IMG_4667.JPG | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | IMG_4705.JPG | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | IMG_4708.JPG | 2019-09-20 09:40 | 1.3M | |
![[IMG]](/icons/image2.gif) | IMG_4714.JPG | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | IMG_4720.JPG | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | IMG_4734.JPG | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | IMG_5141.JPG | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | IMG_5598.JPG | 2019-09-20 09:40 | 150K | |
![[IMG]](/icons/image2.gif) | IMG_5729.jpg | 2019-09-20 09:40 | 524K | |
![[IMG]](/icons/image2.gif) | IMG_5920.jpg | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | IMG_7057.JPG | 2019-09-20 09:40 | 2.1M | |
![[IMG]](/icons/image2.gif) | IMG_7329.JPG | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | IMG_7599-1.JPG | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | IMG_7599.JPG | 2019-09-20 09:40 | 1.3M | |
![[IMG]](/icons/image2.gif) | IMG_8422.JPG | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | IMG_8845.JPG | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | IMG_8921.JPG | 2019-09-20 09:40 | 1.6M | |
![[IMG]](/icons/image2.gif) | IMG_9452.JPG | 2019-09-20 09:40 | 1.0M | |
![[IMG]](/icons/image2.gif) | IMG_9474.JPG | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | I Need A Vacation Poster.jpg | 2019-09-20 09:40 | 237K | |
![[IMG]](/icons/image2.gif) | IYH Donates1.jpg | 2019-09-20 09:40 | 8.9M | |
![[IMG]](/icons/image2.gif) | IYH Donates3.jpg | 2019-09-20 09:40 | 1.8M | |
![[IMG]](/icons/image2.gif) | JGES60thAnniversaryCommittee.jpg | 2019-09-20 09:40 | 182K | |
![[IMG]](/icons/image2.gif) | JVChampionship2019slide.jpg | 2019-09-20 09:40 | 880K | |
![[IMG]](/icons/image2.gif) | Jaha Rosa Defoe shows off books.jpg | 2019-09-20 09:40 | 129K | |
![[IMG]](/icons/image2.gif) | Jazz1.JPG | 2019-09-20 09:40 | 2.1M | |
![[IMG]](/icons/image2.gif) | JazzDock.jpg | 2019-09-20 09:40 | 177K | |
![[IMG]](/icons/image2.gif) | Jereimiah helps 1st honor student Harris show off prize.jpg | 2019-09-20 09:40 | 117K | |
![[ ]](/icons/layout.gif) | Job Posting.pdf | 2019-09-20 09:40 | 85K | |
![[ ]](/icons/compressed.gif) | Job_Descriptions.zip | 2019-09-20 09:40 | 408K | |
![[IMG]](/icons/image2.gif) | June 3.jpg | 2019-09-20 09:40 | 1.8M | |
![[IMG]](/icons/image2.gif) | June 4.JPG | 2019-09-20 09:40 | 278K | |
![[IMG]](/icons/image2.gif) | KeanCAHS.jpg | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | Kean OTJ.jpg | 2019-09-20 09:40 | 443K | |
![[IMG]](/icons/image2.gif) | Kean OTJ2.jpg | 2019-09-20 09:40 | 347K | |
![[IMG]](/icons/image2.gif) | KinderCampers(Classroom2-WesselhoftCastro)singGoodMorningtotheirFamilies.jpg | 2019-09-20 09:40 | 2.4M | |
![[SND]](/icons/sound2.gif) | KingChristian V.mp3 | 2019-09-20 09:40 | 576K | |
![[ ]](/icons/layout.gif) | Kitchen Manager-12.15.17.pdf | 2019-09-20 09:40 | 28K | |
![[ ]](/icons/layout.gif) | Kitchen Manager.pdf | 2019-09-20 09:40 | 29K | |
![[SND]](/icons/sound2.gif) | L.MonsantoBS .mp3 | 2019-09-20 09:40 | 407K | |
![[ ]](/icons/layout.gif) | LEA Program Manager.pdf | 2019-09-20 09:40 | 384K | |
![[ ]](/icons/layout.gif) | LEA Program Manager Job Description.pdf | 2019-09-20 09:40 | 384K | |
![[ ]](/icons/layout.gif) | LEA Program Manager STTJ.pdf | 2019-09-20 09:40 | 276K | |
![[ ]](/icons/layout.gif) | LEA Program Manager STX.pdf | 2019-09-20 09:40 | 322K | |
![[IMG]](/icons/image2.gif) | LMES Lady Lions - 2016 Sports Champ2.jpg | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | LRP.JPG | 2019-09-20 09:40 | 2.1M | |
![[IMG]](/icons/image2.gif) | LaPlaceAndStudents.jpg | 2019-09-20 09:40 | 154K | |
![[IMG]](/icons/image2.gif) | LaPlaceAndStudents2.jpg | 2019-09-20 09:40 | 114K | |
![[IMG]](/icons/image2.gif) | Lab.jpg | 2019-09-20 09:40 | 9.3K | |
![[ ]](/icons/layout.gif) | Laborer-12.15.17.pdf | 2019-09-20 09:40 | 27K | |
![[ ]](/icons/layout.gif) | Laborer.pdf | 2019-09-20 09:40 | 235K | |
![[IMG]](/icons/image2.gif) | Lefttoright-1stplaceNe'JahriJames,DVICEDirectorValricaBryson,2ndPlaceJomarAyalaand3rdPlaceUrielDonelly.jpg | 2019-09-20 09:40 | 889K | |
![[IMG]](/icons/image2.gif) | LornaCYR.jpg | 2019-09-20 09:40 | 933K | |
![[IMG]](/icons/image2.gif) | LtoR-2ndPlaceKimberlyHector&1stPlaceMalikMaillard.JPG | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | LtoR-STTJMathCoordinatorAvonBenjamin,RonitTotwani,AishaKhenani,JulienLoewenstein,ArielPaulandAntillesCoachMicheleHumphries-1.JPG | 2019-09-20 09:40 | 1.8M | |
![[IMG]](/icons/image2.gif) | LtoR-STTJMathCoordinatorAvonBenjamin,RonitTotwani,AishaKhenani,JulienLoewenstein,ArielPaulandAntillesCoachMicheleHumphries.JPG | 2019-09-20 09:40 | 1.8M | |
![[IMG]](/icons/image2.gif) | MIE.JPG | 2019-09-20 09:40 | 116K | |
![[DIR]](/icons/folder.gif) | MLK Shots/ | 2019-09-20 09:03 | - | |
![[IMG]](/icons/image2.gif) | MahalCYR.jpg | 2019-09-20 09:40 | 901K | |
![[ ]](/icons/layout.gif) | Maintenance Engineer I (002).pdf | 2019-09-20 09:40 | 33K | |
![[ ]](/icons/layout.gif) | Maintenance Mechanic-12.15.17.pdf | 2019-09-20 09:40 | 26K | |
![[ ]](/icons/layout.gif) | Maintenance Mechanic.pdf | 2019-09-20 09:40 | 235K | |
![[ ]](/icons/unknown.gif) | Maintenance Mechanic STTJ.docx | 2019-09-20 09:40 | 21K | |
![[IMG]](/icons/image2.gif) | ManUp3.jpg | 2019-09-20 09:40 | 3.6M | |
![[IMG]](/icons/image2.gif) | ManUpHedrington.jpg | 2019-09-20 09:40 | 2.3M | |
![[IMG]](/icons/image2.gif) | ManUpguysListen.jpg | 2019-09-20 09:40 | 1.9M | |
![[IMG]](/icons/image2.gif) | ManUpguysListen2.jpg | 2019-09-20 09:40 | 3.1M | |
![[IMG]](/icons/image2.gif) | MappCYR.jpg | 2019-09-20 09:40 | 927K | |
![[IMG]](/icons/image2.gif) | MappKids2.jpg | 2019-09-20 09:40 | 1.4M | |
![[IMG]](/icons/image2.gif) | MastHeadButtons24.jpg | 2019-09-20 09:40 | 225K | |
![[IMG]](/icons/image2.gif) | MastersDegree.JPG | 2019-09-20 09:40 | 2.1M | |
![[IMG]](/icons/image2.gif) | MathCountsCANCRYN.JPG | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | MayDayMaypole.jpg | 2019-09-20 09:40 | 440K | |
![[IMG]](/icons/image2.gif) | May winner.jpg | 2019-09-20 09:40 | 65K | |
![[IMG]](/icons/image2.gif) | McCollumManUp.jpg | 2019-09-20 09:40 | 75K | |
![[IMG]](/icons/image2.gif) | Mickey Lynch joins Sweet Peppa.JPG | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | MissCAHS2016.jpg | 2019-09-20 09:40 | 329K | |
![[IMG]](/icons/image2.gif) | MissIEKHSFlyerClassyPoster.jpg | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | MissLockhartPageantPoster2015-2016.jpg | 2019-09-20 09:40 | 611K | |
![[IMG]](/icons/image2.gif) | Moorehead.jpg | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | Movie for students.jpg | 2019-09-20 09:40 | 348K | |
![[ ]](/icons/layout.gif) | Movie for students.pdf | 2019-09-20 09:40 | 449K | |
![[ ]](/icons/unknown.gif) | Movie for students.pub | 2019-09-20 09:40 | 1.0M | |
![[DIR]](/icons/folder.gif) | Ms. Timothy/ | 2019-09-20 09:03 | - | |
![[IMG]](/icons/image2.gif) | Muckle 3rd grader depicts her favorite book character Thursday @ Muckle book parade.jpg | 2019-09-20 09:40 | 201K | |
![[IMG]](/icons/image2.gif) | Muckle Principal Espinosa addresses primary students after book parade Thursday.jpg | 2019-09-20 09:40 | 162K | |
![[IMG]](/icons/image2.gif) | Muckle students dress as character in favorite book at Book Character Parade Thursday.jpg | 2019-09-20 09:40 | 177K | |
![[IMG]](/icons/image2.gif) | Muller1.JPG | 2019-09-20 09:40 | 4.6M | |
![[IMG]](/icons/image2.gif) | Muller2.JPG | 2019-09-20 09:40 | 3.9M | |
![[IMG]](/icons/image2.gif) | Muller3.JPG | 2019-09-20 09:40 | 4.0M | |
![[IMG]](/icons/image2.gif) | Muller4.JPG | 2019-09-20 09:40 | 4.2M | |
![[IMG]](/icons/image2.gif) | Muller5.JPG | 2019-09-20 09:40 | 4.3M | |
![[IMG]](/icons/image2.gif) | Muller6.JPG | 2019-09-20 09:40 | 4.5M | |
![[IMG]](/icons/image2.gif) | MullerFARM.jpg | 2019-09-20 09:40 | 3.0M | |
![[IMG]](/icons/image2.gif) | MullerIn.JPG | 2019-09-20 09:40 | 4.7M | |
![[IMG]](/icons/image2.gif) | MyPlate.jpg | 2019-09-20 09:40 | 86K | |
![[IMG]](/icons/image2.gif) | Myplate2.jpg | 2019-09-20 09:40 | 78K | |
![[IMG]](/icons/image2.gif) | NCCEConference.jpg | 2019-09-20 09:40 | 1.3M | |
![[IMG]](/icons/image2.gif) | National Seaperch Collage.jpg | 2019-09-20 09:40 | 592K | |
![[IMG]](/icons/image2.gif) | NellieCYR.jpg | 2019-09-20 09:40 | 901K | |
![[IMG]](/icons/image2.gif) | NotesFull.jpg | 2019-09-20 09:40 | 172K | |
![[IMG]](/icons/image2.gif) | NotesofThanks.png | 2019-09-20 09:40 | 1.1M | |
![[ ]](/icons/layout.gif) | Nutrition Program Assistant.pdf | 2019-09-20 09:40 | 33K | |
![[ ]](/icons/layout.gif) | Nutrition Program Assistant STX 5-9-2016.pdf | 2019-09-20 09:40 | 68K | |
![[IMG]](/icons/image2.gif) | OK your turn to answer.jpg | 2019-09-20 09:40 | 142K | |
![[IMG]](/icons/image2.gif) | Obama-_eacher_of_the_Year-e1462365315162.jpeg | 2019-09-20 09:40 | 91K | |
![[IMG]](/icons/image2.gif) | Officials at Youth Summit 2016.jpg | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | Old Stone poster April 8 2016.jpg | 2019-09-20 09:40 | 1.6M | |
![[IMG]](/icons/image2.gif) | Old Stone poster April 22 2016.jpg | 2019-09-20 09:40 | 3.0M | |
![[IMG]](/icons/image2.gif) | OldStoneposterMarch112016.jpg | 2019-09-20 09:40 | 1.6M | |
![[IMG]](/icons/image2.gif) | OldStoneposterMarch252016.jpg | 2019-09-20 09:40 | 3.0M | |
![[IMG]](/icons/image2.gif) | Old Stone poster May 6 2016.jpg | 2019-09-20 09:40 | 2.6M | |
![[IMG]](/icons/image2.gif) | On tour Oreilly classroom.jpg | 2019-09-20 09:40 | 126K | |
![[IMG]](/icons/image2.gif) | On tour of classrooms.jpg | 2019-09-20 09:40 | 102K | |
![[IMG]](/icons/image2.gif) | Orinwin.jpg | 2019-09-20 09:40 | 1.0M | |
![[IMG]](/icons/image2.gif) | P6192738.jpg | 2019-09-20 09:40 | 454K | |
![[ ]](/icons/unknown.gif) | P6192738.jpg.old | 2019-09-20 09:40 | 1.8M | |
![[IMG]](/icons/image2.gif) | P6192799.jpg | 2019-09-20 09:40 | 422K | |
![[ ]](/icons/unknown.gif) | P6192799.jpg.old | 2019-09-20 09:40 | 1.6M | |
![[IMG]](/icons/image2.gif) | P6192830.jpg | 2019-09-20 09:40 | 481K | |
![[ ]](/icons/unknown.gif) | P6192830.jpg.old | 2019-09-20 09:40 | 1.9M | |
![[IMG]](/icons/image2.gif) | PAINT YOUR SCHOOL PURPLE POSTER.jpg | 2019-09-20 09:40 | 1.0M | |
![[ ]](/icons/layout.gif) | PBIS District Coach.pdf | 2019-09-20 09:40 | 44K | |
![[IMG]](/icons/image2.gif) | PBSCourse.jpg | 2019-09-20 09:40 | 131K | |
![[DIR]](/icons/folder.gif) | PDF/ | 2019-09-20 09:04 | - | |
![[IMG]](/icons/image2.gif) | PHOTO-201[1].jpg | 2019-09-20 09:40 | 37K | |
![[ ]](/icons/layout.gif) | PROGRAM ASSISTANT-(AEFLA).pdf | 2019-09-20 09:40 | 37K | |
![[IMG]](/icons/image2.gif) | PRTrip2.jpg | 2019-09-20 09:40 | 4.1M | |
![[IMG]](/icons/image2.gif) | PRtrip1.jpg | 2019-09-20 09:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | PTSAgood.jpg | 2019-09-20 09:40 | 93K | |
![[IMG]](/icons/image2.gif) | Parade1.jpg | 2019-09-20 09:40 | 282K | |
![[IMG]](/icons/image2.gif) | Parade2.jpg | 2019-09-20 09:40 | 337K | |
![[IMG]](/icons/image2.gif) | Parade4.jpg | 2019-09-20 09:40 | 248K | |
![[IMG]](/icons/image2.gif) | Parade5.jpg | 2019-09-20 09:40 | 189K | |
![[IMG]](/icons/image2.gif) | Parade6.jpg | 2019-09-20 09:40 | 198K | |
![[IMG]](/icons/image2.gif) | Parade8.jpg | 2019-09-20 09:40 | 264K | |
![[IMG]](/icons/image2.gif) | Parade10.jpg | 2019-09-20 09:40 | 336K | |
![[ ]](/icons/layout.gif) | Paraprofessional.pdf | 2019-09-20 09:40 | 304K | |
![[IMG]](/icons/image2.gif) | ParentRoom1.JPG | 2019-09-20 09:40 | 92K | |
![[IMG]](/icons/image2.gif) | Parent Summit Official Flyer.jpg | 2019-09-20 09:40 | 244K | |
![[IMG]](/icons/image2.gif) | Parent Summit Official Flyer2.jpg | 2019-09-20 09:40 | 448K | |
![[IMG]](/icons/image2.gif) | Parent Summit Official Flyer3.jpg | 2019-09-20 09:40 | 210K | |
![[IMG]](/icons/image2.gif) | Parsonviewing.jpg | 2019-09-20 09:40 | 144K | |
![[IMG]](/icons/image2.gif) | ParsonviewingFull.jpg | 2019-09-20 09:40 | 408K | |
![[ ]](/icons/layout.gif) | Payroll Audit Clerk I.pdf | 2019-09-20 09:40 | 235K | |
![[IMG]](/icons/image2.gif) | Platform guests.jpg | 2019-09-20 09:40 | 164K | |
![[IMG]](/icons/image2.gif) | Posing with students & staff2.jpg | 2019-09-20 09:40 | 131K | |
![[IMG]](/icons/image2.gif) | Posingwith studentsstaff2.jpg | 2019-09-20 09:40 | 131K | |
![[IMG]](/icons/image2.gif) | PosterEventAlvincent.jpg | 2019-09-20 09:40 | 389K | |
![[IMG]](/icons/image2.gif) | Primary3.jpg | 2019-09-20 09:40 | 4.7M | |
![[ ]](/icons/layout.gif) | Principal.pdf | 2019-09-20 09:40 | 245K | |
![[IMG]](/icons/image2.gif) | ProcurementBanner.png | 2019-09-20 09:40 | 153K | |
![[IMG]](/icons/image2.gif) | ProcurementLogo.png | 2019-09-20 09:40 | 188K | |
![[IMG]](/icons/image2.gif) | ProcurementLogo2.png | 2019-09-20 09:40 | 162K | |
![[ ]](/icons/layout.gif) | Program Assistant -SandH.pdf | 2019-09-20 09:40 | 178K | |
![[ ]](/icons/layout.gif) | Program Assistant.pdf | 2019-09-20 09:40 | 303K | |
![[ ]](/icons/unknown.gif) | Program Mon STTJ.doc | 2019-09-20 09:40 | 54K | |
![[ ]](/icons/layout.gif) | Program Mon STTJ.pdf | 2019-09-20 09:40 | 221K | |
![[ ]](/icons/layout.gif) | Program Monitor.pdf | 2019-09-20 09:40 | 29K | |
![[IMG]](/icons/image2.gif) | ProjectSlide-1.jpg | 2019-09-20 09:40 | 496K | |
![[IMG]](/icons/image2.gif) | ProjectSlide-2.jpg | 2019-09-20 09:40 | 627K | |
![[IMG]](/icons/image2.gif) | ProjectSlide.jpg | 2019-09-20 09:40 | 496K | |
![[IMG]](/icons/image2.gif) | Prom2.jpg | 2019-09-20 09:40 | 5.8M | |
![[IMG]](/icons/image2.gif) | Prom3.jpg | 2019-09-20 09:40 | 7.9M | |
![[IMG]](/icons/image2.gif) | Prom4.jpg | 2019-09-20 09:40 | 6.6M | |
![[IMG]](/icons/image2.gif) | PromKing.jpg | 2019-09-20 09:40 | 5.3M | |
![[ ]](/icons/layout.gif) | Public Info Officer.pdf | 2019-09-20 09:40 | 27K | |
![[ ]](/icons/unknown.gif) | RAC PowerPoint.pptx | 2019-09-20 09:40 | 235K | |
![[IMG]](/icons/image2.gif) | REvival1.jpg | 2019-09-20 09:40 | 52K | |
![[ ]](/icons/layout.gif) | Receiving Officer.pdf | 2019-09-20 09:40 | 190K | |
![[IMG]](/icons/image2.gif) | Recog1.JPG | 2019-09-20 09:40 | 2.2M | |
![[IMG]](/icons/image2.gif) | Recog2.JPG | 2019-09-20 09:40 | 2.6M | |
![[IMG]](/icons/image2.gif) | Recog3.JPG | 2019-09-20 09:40 | 2.0M | |
![[IMG]](/icons/image2.gif) | Recog4.JPG | 2019-09-20 09:40 | 2.1M | |
![[IMG]](/icons/image2.gif) | Recog4A.JPG | 2019-09-20 09:40 | 1.6M | |
![[IMG]](/icons/image2.gif) | Recog5.jpg | 2019-09-20 09:40 | 4.7M | |
![[IMG]](/icons/image2.gif) | Recog6.jpg | 2019-09-20 09:40 | 5.6M | |
![[ ]](/icons/layout.gif) | Registrar 12.15.17.pdf | 2019-09-20 09:40 | 31K | |
![[IMG]](/icons/image2.gif) | Resized_R.jpg | 2019-09-20 09:40 | 62K | |
![[IMG]](/icons/image2.gif) | Revival5.jpg | 2019-09-20 09:40 | 67K | |
![[IMG]](/icons/image2.gif) | Revival6.jpg | 2019-09-20 09:40 | 40K | |
![[IMG]](/icons/image2.gif) | Ricardo2.jpg | 2019-09-20 09:40 | 1.3M | |
![[IMG]](/icons/image2.gif) | Ricardo3.jpg | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | Ricardo4.jpg | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | Ricardo5.jpg | 2019-09-20 09:40 | 1.4M | |
![[IMG]](/icons/image2.gif) | Ricardo Richards - LEGO winners.jpg | 2019-09-20 09:40 | 128K | |
![[IMG]](/icons/image2.gif) | RicardoVI.jpg | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | RipplesManUp.jpg | 2019-09-20 09:40 | 77K | |
![[IMG]](/icons/image2.gif) | RochardsonwithStudent.jpg | 2019-09-20 09:40 | 110K | |
![[IMG]](/icons/image2.gif) | Roland Wells & Jacob Henry.JPG | 2019-09-20 09:40 | 753K | |
![[IMG]](/icons/image2.gif) | Rubic Cube.jpg | 2019-09-20 09:40 | 132K | |
![[IMG]](/icons/image2.gif) | STEAMPoster.jpg | 2019-09-20 09:40 | 208K | |
![[IMG]](/icons/image2.gif) | STEAM Poster2.jpg | 2019-09-20 09:40 | 208K | |
![[IMG]](/icons/image2.gif) | STJ2.jpg | 2019-09-20 09:40 | 126K | |
![[IMG]](/icons/image2.gif) | STJ3.jpg | 2019-09-20 09:40 | 121K | |
![[IMG]](/icons/image2.gif) | STJ4.jpg | 2019-09-20 09:40 | 144K | |
![[IMG]](/icons/image2.gif) | STJ5.jpg | 2019-09-20 09:40 | 144K | |
![[IMG]](/icons/image2.gif) | STJSlide.jpg | 2019-09-20 09:40 | 848K | |
![[ ]](/icons/layout.gif) | STTJ 2016 District STEAM Fair Results.pdf | 2019-09-20 09:40 | 506K | |
![[IMG]](/icons/image2.gif) | STTJESL.jpg | 2019-09-20 09:40 | 228K | |
![[IMG]](/icons/image2.gif) | STTJStartEndTimesSY201920External.png | 2019-09-20 09:40 | 1.6M | |
![[DIR]](/icons/folder.gif) | STTJ Teach of the Year/ | 2019-09-20 09:34 | - | |
![[IMG]](/icons/image2.gif) | STXExpo2016.jpg | 2019-09-20 09:40 | 2.4M | |
![[IMG]](/icons/image2.gif) | STXMaintence.jpg | 2019-09-20 09:40 | 188K | |
![[IMG]](/icons/image2.gif) | STX Rescue Paramedics show Gardine 1st graders how to handle an injured person.jpg | 2019-09-20 09:40 | 128K | |
![[IMG]](/icons/image2.gif) | STXStartEndTimesSY201920External.png | 2019-09-20 09:40 | 1.6M | |
![[IMG]](/icons/image2.gif) | STXTESL.jpg | 2019-09-20 09:40 | 1.8M | |
![[IMG]](/icons/image2.gif) | Sax1.jpg | 2019-09-20 09:40 | 591K | |
![[IMG]](/icons/image2.gif) | Sax2.jpg | 2019-09-20 09:40 | 485K | |
![[ ]](/icons/layout.gif) | School Bus Operator-12.15.17.pdf | 2019-09-20 09:40 | 27K | |
![[ ]](/icons/layout.gif) | School Lunch Warehouse Manager.pdf | 2019-09-20 09:40 | 27K | |
![[ ]](/icons/layout.gif) | School Monitor.docx.pdf | 2019-09-20 09:40 | 294K | |
![[ ]](/icons/layout.gif) | School Monitor 12.15.17.pdf | 2019-09-20 09:40 | 27K | |
![[ ]](/icons/layout.gif) | School Nurse.pdf | 2019-09-20 09:40 | 23K | |
![[IMG]](/icons/image2.gif) | Sea1.jpg | 2019-09-20 09:40 | 3.7M | |
![[DIR]](/icons/folder.gif) | SenatorialForum/ | 2019-09-20 09:34 | - | |
![[IMG]](/icons/image2.gif) | Serano-Griffith Interacts With Students.jpg | 2019-09-20 09:40 | 3.4M | |
![[IMG]](/icons/image2.gif) | SibRead1.jpg | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | SibRead2.jpg | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | SibRead3.jpg | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | SibRead4.jpg | 2019-09-20 09:40 | 2.2M | |
![[IMG]](/icons/image2.gif) | SibRead5.jpg | 2019-09-20 09:40 | 4.2M | |
![[IMG]](/icons/image2.gif) | SibRead6.jpg | 2019-09-20 09:40 | 3.5M | |
![[IMG]](/icons/image2.gif) | SibRead7.jpg | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | SibRead8.jpg | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | SibRead9.jpg | 2019-09-20 09:40 | 2.2M | |
![[IMG]](/icons/image2.gif) | SibRead10.jpg | 2019-09-20 09:40 | 2.2M | |
![[IMG]](/icons/image2.gif) | SibillyBalloons.JPG | 2019-09-20 09:40 | 4.5M | |
![[IMG]](/icons/image2.gif) | SibillyBalloons2.JPG | 2019-09-20 09:40 | 4.7M | |
![[IMG]](/icons/image2.gif) | SibillyBeads.JPG | 2019-09-20 09:40 | 4.9M | |
![[IMG]](/icons/image2.gif) | SibillyBeads2.JPG | 2019-09-20 09:40 | 4.6M | |
![[IMG]](/icons/image2.gif) | SibillyFacePainting.JPG | 2019-09-20 09:40 | 5.4M | |
![[IMG]](/icons/image2.gif) | SibillyGirls.JPG | 2019-09-20 09:40 | 4.2M | |
![[IMG]](/icons/image2.gif) | SibillyGoldfish.JPG | 2019-09-20 09:40 | 6.7M | |
![[IMG]](/icons/image2.gif) | SibillyGoldfish2.JPG | 2019-09-20 09:40 | 3.7M | |
![[IMG]](/icons/image2.gif) | SibillyMasks.JPG | 2019-09-20 09:40 | 3.5M | |
![[IMG]](/icons/image2.gif) | SibillyMummy1a.JPG | 2019-09-20 09:40 | 3.9M | |
![[IMG]](/icons/image2.gif) | SibillyMummyBones.JPG | 2019-09-20 09:40 | 3.9M | |
![[IMG]](/icons/image2.gif) | SibillyMummyBones2.JPG | 2019-09-20 09:40 | 3.8M | |
![[IMG]](/icons/image2.gif) | SibillylegoChrisM3rdMicahC4th.jpg | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | Slide(HallPass(HumanResources).jpg | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | Slide(HallPassCultEd).jpg | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | Slide(HallPassCyber).jpg | 2019-09-20 09:40 | 866K | |
![[IMG]](/icons/image2.gif) | SlideAdultEd.jpg | 2019-09-20 09:40 | 841K | |
![[IMG]](/icons/image2.gif) | SlideFashionEaster.jpg | 2019-09-20 09:40 | 1.8M | |
![[IMG]](/icons/image2.gif) | SlideFashionEasterHighlights.jpg | 2019-09-20 09:40 | 553K | |
![[IMG]](/icons/image2.gif) | SlideGardine.jpg | 2019-09-20 09:40 | 8.0M | |
![[IMG]](/icons/image2.gif) | SlideHallPassCTE.jpg | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | SlideHallPassCyber.jpg | 2019-09-20 09:40 | 866K | |
![[IMG]](/icons/image2.gif) | SlideHopkins.jpg | 2019-09-20 09:40 | 715K | |
![[IMG]](/icons/image2.gif) | SlideLegalServices.jpg | 2019-09-20 09:40 | 872K | |
![[IMG]](/icons/image2.gif) | SlideMaintenance.jpg | 2019-09-20 09:40 | 796K | |
![[IMG]](/icons/image2.gif) | SlideUnderconstruction2.jpg | 2019-09-20 09:40 | 411K | |
![[IMG]](/icons/image2.gif) | SlideWearRed.jpg | 2019-09-20 09:40 | 859K | |
![[IMG]](/icons/image2.gif) | SmarterBalancedGraphic1.jpg | 2019-09-20 09:40 | 392K | |
![[IMG]](/icons/image2.gif) | SmarterBalancedGraphic2.jpg | 2019-09-20 09:40 | 371K | |
![[IMG]](/icons/image2.gif) | Smarter Balanced Parent Question and Answer2.jpg | 2019-09-20 09:40 | 408K | |
![[IMG]](/icons/image2.gif) | Smarter Balanced Parent Question and Answer3.jpg | 2019-09-20 09:40 | 255K | |
![[IMG]](/icons/image2.gif) | SmarterBalancedforCalendar.jpg | 2019-09-20 09:40 | 617K | |
![[IMG]](/icons/image2.gif) | SpecialEdLetter.jpg | 2019-09-20 09:40 | 512K | |
![[ ]](/icons/layout.gif) | Special Education Paraprofessional.pdf | 2019-09-20 09:40 | 353K | |
![[ ]](/icons/layout.gif) | Special Education Supervisor.pdf | 2019-09-20 09:40 | 302K | |
![[DIR]](/icons/folder.gif) | Special Funding/ | 2019-09-20 09:34 | - | |
![[DIR]](/icons/folder.gif) | Sports and Athletics/ | 2019-09-20 09:03 | - | |
![[IMG]](/icons/image2.gif) | StateTeacher1.jpg | 2019-09-20 09:40 | 511K | |
![[IMG]](/icons/image2.gif) | StateTeacher2.jpg | 2019-09-20 09:40 | 207K | |
![[IMG]](/icons/image2.gif) | StateTeacher3.jpg | 2019-09-20 09:40 | 225K | |
![[IMG]](/icons/image2.gif) | StateTeacher4.jpg | 2019-09-20 09:40 | 354K | |
![[IMG]](/icons/image2.gif) | StateTeacher5.jpg | 2019-09-20 09:40 | 98K | |
![[IMG]](/icons/image2.gif) | Steam1.jpg | 2019-09-20 09:40 | 2.7M | |
![[IMG]](/icons/image2.gif) | StudentElectrician.jpg | 2019-09-20 09:40 | 101K | |
![[DIR]](/icons/folder.gif) | Student Life Highlights/ | 2019-09-20 09:34 | - | |
![[IMG]](/icons/image2.gif) | StudentVsTeacher.jpg | 2019-09-20 09:40 | 844K | |
![[IMG]](/icons/image2.gif) | Summit Ice BreakerCubanGuy.jpg | 2019-09-20 09:40 | 3.4M | |
![[IMG]](/icons/image2.gif) | SummitSmile.jpg | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | Summittable.jpg | 2019-09-20 09:40 | 3.2M | |
![[ ]](/icons/layout.gif) | Supervisor Pupil Transportation.pdf | 2019-09-20 09:40 | 303K | |
![[IMG]](/icons/image2.gif) | Supt Wms congrats Honoree.jpg | 2019-09-20 09:40 | 139K | |
![[IMG]](/icons/image2.gif) | Sweet Peppa Band Performs.JPG | 2019-09-20 09:40 | 1.4M | |
![[ ]](/icons/layout.gif) | TECHNOLOGY NETWORK TECHNICIAN.pdf | 2019-09-20 09:40 | 200K | |
![[IMG]](/icons/image2.gif) | TGISundayConcertFlyer.jpg | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | TeacherSurvey.jpg | 2019-09-20 09:40 | 131K | |
![[IMG]](/icons/image2.gif) | TeacherSurveycopy.jpg | 2019-09-20 09:40 | 131K | |
![[IMG]](/icons/image2.gif) | TeachersAcademy.jpg | 2019-09-20 09:40 | 388K | |
![[IMG]](/icons/image2.gif) | TempMods.jpg | 2019-09-20 09:40 | 613K | |
![[IMG]](/icons/image2.gif) | The Cuban Guy interacts with student.jpg | 2019-09-20 09:40 | 3.6M | |
![[SND]](/icons/sound2.gif) | TheLibertyBell.mp3 | 2019-09-20 09:40 | 442K | |
![[IMG]](/icons/image2.gif) | Todman2016BeeII.jpg | 2019-09-20 09:40 | 171K | |
![[IMG]](/icons/image2.gif) | Top Students Listen to Guest Speaker.jpg | 2019-09-20 09:40 | 152K | |
![[IMG]](/icons/image2.gif) | TourGovHouse.JPG | 2019-09-20 09:40 | 1.7M | |
![[ ]](/icons/layout.gif) | Trauma Informed Student Care Flyer.pdf | 2019-09-20 09:40 | 762K | |
![[ ]](/icons/layout.gif) | Truckdriver.pdf | 2019-09-20 09:40 | 237K | |
![[IMG]](/icons/image2.gif) | Tshirts.JPG | 2019-09-20 09:40 | 1.2M | |
![[IMG]](/icons/image2.gif) | Tuitt1.JPG | 2019-09-20 09:40 | 3.4M | |
![[IMG]](/icons/image2.gif) | Tuitt1a.JPG | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | Tuitt2.JPG | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | Tuitt4.JPG | 2019-09-20 09:40 | 3.0M | |
![[IMG]](/icons/image2.gif) | Tuitt5.JPG | 2019-09-20 09:40 | 2.4M | |
![[IMG]](/icons/image2.gif) | TuittArt.JPG | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | TuittBee.JPG | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | TuittBee2.jpg | 2019-09-20 09:40 | 211K | |
![[IMG]](/icons/image2.gif) | TuittBee3.jpg | 2019-09-20 09:40 | 384K | |
![[IMG]](/icons/image2.gif) | TuittCircle.JPG | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | TuittFashion.JPG | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | TuittFashion1.JPG | 2019-09-20 09:40 | 3.4M | |
![[IMG]](/icons/image2.gif) | TuittFashion2.JPG | 2019-09-20 09:40 | 3.4M | |
![[IMG]](/icons/image2.gif) | TuittFashion3.JPG | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | TuittFashion4.JPG | 2019-09-20 09:40 | 3.4M | |
![[IMG]](/icons/image2.gif) | TuittFashion5.JPG | 2019-09-20 09:40 | 3.3M | |
![[IMG]](/icons/image2.gif) | VIDE2013CGAfunds10.14.2015.jpg | 2019-09-20 09:41 | 568K | |
![[IMG]](/icons/image2.gif) | VIDEColorLogosmall.png | 2019-09-20 09:41 | 154K | |
![[IMG]](/icons/image2.gif) | VIDEColorLogosmall1.png | 2019-09-20 09:41 | 67K | |
![[IMG]](/icons/image2.gif) | VIDEColorLogosmall2.png | 2019-09-20 09:41 | 70K | |
![[ ]](/icons/layout.gif) | VIDE FFY2016 Waiver Request_8.16.2018.pdf | 2019-09-20 09:41 | 670K | |
![[IMG]](/icons/image2.gif) | VIDELogo100px-01.png | 2019-09-20 09:41 | 167K | |
![[IMG]](/icons/image2.gif) | VIDELogoColorSeal110px.jpg | 2019-09-20 09:41 | 81K | |
![[IMG]](/icons/image2.gif) | VIDELogoColorSeal300px.jpg | 2019-09-20 09:41 | 220K | |
![[IMG]](/icons/image2.gif) | VIDEStaffobserveGoRedDay.jpg | 2019-09-20 09:41 | 186K | |
![[IMG]](/icons/image2.gif) | VIDEVoice02.jpg | 2019-10-18 20:01 | 80K | |
![[IMG]](/icons/image2.gif) | VIDEWebSlider.png | 2019-09-20 09:41 | 1.8M | |
![[IMG]](/icons/image2.gif) | VITRIADATExpoFlyer1.jpg | 2019-09-20 09:41 | 2.0M | |
![[ ]](/icons/layout.gif) | Vacancy Descriptions.pdf | 2019-09-20 09:40 | 231K | |
![[IMG]](/icons/image2.gif) | Vacation Raffle Advertisement - Cynthia Graham 1.jpg | 2019-09-20 09:40 | 124K | |
![[IMG]](/icons/image2.gif) | Vending cultural items.JPG | 2019-09-20 09:41 | 203K | |
![[ ]](/icons/layout.gif) | Volunteer_Application.pdf | 2019-09-20 09:41 | 180K | |
![[IMG]](/icons/image2.gif) | WOTYC19Slide.jpg | 2019-09-20 09:41 | 883K | |
![[IMG]](/icons/image2.gif) | Walk-A-Thon.jpg | 2019-09-20 09:41 | 112K | |
![[IMG]](/icons/image2.gif) | Walkathon.jpg | 2019-09-20 09:41 | 353K | |
![[ ]](/icons/layout.gif) | Warehouse Manager (School Lunch) JA.pdf | 2019-09-20 09:41 | 29K | |
![[ ]](/icons/layout.gif) | Warehouse Manager.pdf | 2019-09-20 09:41 | 242K | |
![[ ]](/icons/layout.gif) | Warehouse Receiving Officer.pdf | 2019-09-20 09:41 | 42K | |
![[ ]](/icons/layout.gif) | WearRedSTX.pdf | 2019-09-20 09:41 | 338K | |
![[IMG]](/icons/image2.gif) | Winners.JPG | 2019-09-20 09:41 | 1.8M | |
![[IMG]](/icons/image2.gif) | Woodson1.JPG | 2019-09-20 09:41 | 5.2M | |
![[IMG]](/icons/image2.gif) | Woodson2.JPG | 2019-09-20 09:41 | 5.8M | |
![[IMG]](/icons/image2.gif) | Woodson Hydroponics.jpg | 2019-09-20 09:41 | 147K | |
![[IMG]](/icons/image2.gif) | WoodsonJRHonorSot.jpg | 2019-09-20 09:41 | 2.1M | |
![[IMG]](/icons/image2.gif) | WoodsonRecital.jpg | 2019-09-20 09:41 | 498K | |
![[ ]](/icons/layout.gif) | WorkshopPerformance.pdf | 2019-09-20 09:41 | 3.6M | |
![[IMG]](/icons/image2.gif) | Zahra O'Reilly and Masqueraders.JPG | 2019-09-20 09:41 | 143K | |
![[DIR]](/icons/folder.gif) | _spmedia_thumbs/ | 2019-10-29 13:55 | - | |
![[IMG]](/icons/image2.gif) | aaen-background-black-team_he5yvl.jpg | 2019-09-20 09:40 | 114K | |
![[IMG]](/icons/image2.gif) | arted2.jpg | 2019-09-20 09:40 | 438K | |
![[DIR]](/icons/folder.gif) | aviary/ | 2019-09-20 09:00 | - | |
![[IMG]](/icons/image2.gif) | b2s-01.png | 2019-09-20 09:40 | 1.4M | |
![[IMG]](/icons/image2.gif) | bac.jpg | 2019-09-20 09:40 | 629K | |
![[DIR]](/icons/folder.gif) | banners/ | 2019-09-20 09:01 | - | |
![[IMG]](/icons/image2.gif) | calypso.jpg | 2019-09-20 09:40 | 96K | |
![[IMG]](/icons/image2.gif) | cancrynmemo.jpg | 2019-09-20 09:40 | 74K | |
![[IMG]](/icons/image2.gif) | cancrynmemo.png | 2019-09-20 09:40 | 283K | |
![[IMG]](/icons/image2.gif) | carnival queen.jpg | 2019-09-20 09:40 | 97K | |
![[IMG]](/icons/image2.gif) | chrome-enroll.png | 2019-09-20 09:40 | 9.0K | |
![[DIR]](/icons/folder.gif) | com_quantummanager/ | 2019-09-20 09:01 | - | |
![[DIR]](/icons/folder.gif) | comm/ | 2019-09-20 09:03 | - | |
![[IMG]](/icons/image2.gif) | costarRicaJune.jpg | 2019-09-20 09:40 | 158K | |
![[IMG]](/icons/image2.gif) | culturalglitz.jpg | 2019-09-20 09:40 | 299K | |
![[IMG]](/icons/image2.gif) | dar.jpg | 2019-09-20 09:40 | 54K | |
![[DIR]](/icons/folder.gif) | divisions/ | 2019-09-20 09:03 | - | |
![[IMG]](/icons/image2.gif) | downloadapdf.jpg | 2019-09-20 09:40 | 30K | |
![[IMG]](/icons/image2.gif) | easterslide.jpg | 2019-09-20 09:40 | 611K | |
![[IMG]](/icons/image2.gif) | fathersdayflyer2.jpg | 2019-09-20 09:40 | 302K | |
![[IMG]](/icons/image2.gif) | fatherstogether.jpg | 2019-09-20 09:40 | 4.9M | |
![[IMG]](/icons/image2.gif) | fatherstogether2.jpg | 2019-09-20 09:40 | 361K | |
![[DIR]](/icons/folder.gif) | favico/ | 2019-10-01 14:37 | - | |
![[ ]](/icons/layout.gif) | finalifb013-janitorial.pdf | 2019-09-20 09:40 | 733K | |
![[IMG]](/icons/image2.gif) | finalifb013-janitorial_page_1.jpg | 2019-09-20 09:40 | 81K | |
![[IMG]](/icons/image2.gif) | finalifb013-janitorial_page_2.jpg | 2019-09-20 09:40 | 56K | |
![[IMG]](/icons/image2.gif) | finalifb013-janitorial_page_3.jpg | 2019-09-20 09:40 | 42K | |
![[IMG]](/icons/image2.gif) | group.jpg | 2019-09-20 09:40 | 3.5M | |
![[IMG]](/icons/image2.gif) | guitar.jpg | 2019-09-20 09:40 | 451K | |
![[DIR]](/icons/folder.gif) | headers/ | 2019-09-20 09:03 | - | |
![[DIR]](/icons/folder.gif) | hr/ | 2019-09-20 09:03 | - | |
![[IMG]](/icons/image2.gif) | image.png | 2019-09-20 09:40 | 349K | |
![[IMG]](/icons/image2.gif) | image002.jpg | 2019-09-20 09:40 | 144K | |
![[IMG]](/icons/image2.gif) | image002.png | 2019-09-20 09:40 | 616K | |
![[IMG]](/icons/image2.gif) | image003.jpg | 2019-09-20 09:40 | 117K | |
![[IMG]](/icons/image2.gif) | image008.png | 2019-09-20 09:40 | 354K | |
![[IMG]](/icons/image2.gif) | image2.JPG | 2019-09-20 09:40 | 1.0M | |
![[IMG]](/icons/image2.gif) | img-20190920-wa0012.jpg | 2019-10-29 13:55 | 332K | |
![[TXT]](/icons/text.gif) | index.html | 2019-09-23 16:22 | 31 | |
![[IMG]](/icons/image2.gif) | jazz2.JPG | 2019-09-20 09:40 | 1.5M | |
![[IMG]](/icons/image2.gif) | jazz3.JPG | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | jazz4.JPG | 2019-09-20 09:40 | 3.0M | |
![[IMG]](/icons/image2.gif) | jazz5.JPG | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | jazz6.JPG | 2019-09-20 09:40 | 2.6M | |
![[IMG]](/icons/image2.gif) | jazz7.JPG | 2019-09-20 09:40 | 876K | |
![[IMG]](/icons/image2.gif) | jazz8.JPG | 2019-09-20 09:40 | 1.0M | |
![[IMG]](/icons/image2.gif) | jazz10.JPG | 2019-09-20 09:40 | 1.3M | |
![[IMG]](/icons/image2.gif) | joomla_black.png | 2019-09-20 21:02 | 4.9K | |
![[IMG]](/icons/image2.gif) | mascots.jpg | 2019-09-20 09:40 | 372K | |
![[IMG]](/icons/image2.gif) | maypole2.jpg | 2019-09-20 09:40 | 164K | |
![[DIR]](/icons/folder.gif) | misc/ | 2019-09-27 18:51 | - | |
![[ ]](/icons/layout.gif) | monthly-calendar-october3064.pdf | 2019-10-07 09:58 | 909K | |
![[IMG]](/icons/image2.gif) | myplate3.jpg | 2019-09-20 09:40 | 73K | |
![[IMG]](/icons/image2.gif) | nasa1.jpg | 2019-09-20 09:40 | 2.2M | |
![[IMG]](/icons/image2.gif) | nasa2.jpg | 2019-09-20 09:40 | 2.1M | |
![[IMG]](/icons/image2.gif) | nasa3.jpg | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | nasa4.jpg | 2019-09-20 09:40 | 2.3M | |
![[IMG]](/icons/image2.gif) | nasa5.jpg | 2019-09-20 09:40 | 2.2M | |
![[IMG]](/icons/image2.gif) | nasa6.jpg | 2019-09-20 09:40 | 2.0M | |
![[IMG]](/icons/image2.gif) | nasa7.jpg | 2019-09-20 09:40 | 1.8M | |
![[IMG]](/icons/image2.gif) | nitecap usvi.jpg | 2019-09-20 09:40 | 1.9M | |
![[IMG]](/icons/image2.gif) | nitecapusvi.jpg | 2019-09-20 09:40 | 1.9M | |
![[DIR]](/icons/folder.gif) | oit/ | 2019-09-20 09:03 | - | |
![[DIR]](/icons/folder.gif) | orginals/ | 2019-09-20 09:04 | - | |
![[IMG]](/icons/image2.gif) | overview.jpg | 2019-09-20 09:40 | 4.2M | |
![[IMG]](/icons/image2.gif) | parade9.jpg | 2019-09-20 09:40 | 406K | |
![[IMG]](/icons/image2.gif) | parade11.jpg | 2019-09-20 09:40 | 206K | |
![[DIR]](/icons/folder.gif) | pbis/ | 2019-10-11 10:40 | - | |
![[DIR]](/icons/folder.gif) | pbl-fire-fighters/ | 2019-10-17 10:54 | - | |
![[ ]](/icons/unknown.gif) | pearl-bjpg. | 2019-10-02 14:31 | 81K | |
![[ ]](/icons/unknown.gif) | pearl-bjpg1. | 2019-10-07 07:37 | 81K | |
![[IMG]](/icons/image2.gif) | people-banner_0.jpg | 2019-09-20 09:40 | 292K | |
![[IMG]](/icons/image2.gif) | personaldevelopment.png | 2019-09-20 09:40 | 1.4M | |
![[IMG]](/icons/image2.gif) | poetryoutloud.jpg | 2019-09-20 09:40 | 119K | |
![[IMG]](/icons/image2.gif) | potterCYR.jpg | 2019-09-20 09:40 | 924K | |
![[IMG]](/icons/image2.gif) | powered_by.png | 2019-09-20 21:02 | 3.1K | |
![[DIR]](/icons/folder.gif) | public_relations/ | 2019-11-12 10:54 | - | |
![[IMG]](/icons/image2.gif) | quadrille.jpg | 2019-09-20 09:40 | 368K | |
![[IMG]](/icons/image2.gif) | read2.jpg | 2019-09-20 09:40 | 396K | |
![[IMG]](/icons/image2.gif) | read3.jpg | 2019-09-20 09:40 | 420K | |
![[IMG]](/icons/image2.gif) | read4.jpg | 2019-09-20 09:40 | 386K | |
![[DIR]](/icons/folder.gif) | remote/ | 2019-09-20 09:34 | - | |
![[IMG]](/icons/image2.gif) | revival1a.jpg | 2019-09-20 09:40 | 48K | |
![[IMG]](/icons/image2.gif) | revival2.jpg | 2019-09-20 09:40 | 52K | |
![[IMG]](/icons/image2.gif) | revival3.jpg | 2019-09-20 09:40 | 42K | |
![[IMG]](/icons/image2.gif) | revival4.jpg | 2019-09-20 09:40 | 47K | |
![[IMG]](/icons/image2.gif) | revivalyes.JPG | 2019-09-20 09:40 | 2.2M | |
![[DIR]](/icons/folder.gif) | sampledata/ | 2019-09-20 21:02 | - | |
![[DIR]](/icons/folder.gif) | school_logo/ | 2019-10-30 10:21 | - | |
![[IMG]](/icons/image2.gif) | sea2.jpg | 2019-09-20 09:40 | 4.6M | |
![[IMG]](/icons/image2.gif) | sea3.jpg | 2019-09-20 09:40 | 3.7M | |
![[IMG]](/icons/image2.gif) | sea4.jpg | 2019-09-20 09:40 | 4.1M | |
![[IMG]](/icons/image2.gif) | sea5.jpg | 2019-09-20 09:40 | 130K | |
![[IMG]](/icons/image2.gif) | sea6.jpg | 2019-09-20 09:40 | 92K | |
![[IMG]](/icons/image2.gif) | sea7.jpg | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | sea8.jpg | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | sea9.jpg | 2019-09-20 09:40 | 1.7M | |
![[IMG]](/icons/image2.gif) | sea10.jpg | 2019-09-20 09:40 | 3.9M | |
![[IMG]](/icons/image2.gif) | slide_47.jpg | 2019-09-20 09:40 | 52K | |
![[DIR]](/icons/folder.gif) | slider6/ | 2019-09-20 09:34 | - | |
![[IMG]](/icons/image2.gif) | smarterBalanced.png | 2019-09-20 09:40 | 1.8M | |
![[IMG]](/icons/image2.gif) | softball.JPG | 2019-09-20 09:40 | 2.0M | |
![[IMG]](/icons/image2.gif) | sos.png | 2019-09-20 09:40 | 90K | |
![[IMG]](/icons/image2.gif) | spring concert.jpg | 2019-09-20 09:40 | 179K | |
![[IMG]](/icons/image2.gif) | stcroixJuneraffle.jpg | 2019-09-20 09:40 | 82K | |
![[IMG]](/icons/image2.gif) | steam1a.jpg | 2019-09-20 09:40 | 3.0M | |
![[IMG]](/icons/image2.gif) | steam2.jpg | 2019-09-20 09:40 | 5.0M | |
![[IMG]](/icons/image2.gif) | steam2b.jpg | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | steam3.jpg | 2019-09-20 09:40 | 2.8M | |
![[IMG]](/icons/image2.gif) | steam4.jpg | 2019-09-20 09:40 | 3.0M | |
![[IMG]](/icons/image2.gif) | steam5.jpg | 2019-09-20 09:40 | 2.7M | |
![[IMG]](/icons/image2.gif) | steam6.jpg | 2019-09-20 09:40 | 2.3M | |
![[IMG]](/icons/image2.gif) | steam7.jpg | 2019-09-20 09:40 | 2.3M | |
![[IMG]](/icons/image2.gif) | steam8.jpg | 2019-09-20 09:40 | 2.4M | |
![[IMG]](/icons/image2.gif) | steam9.jpg | 2019-09-20 09:40 | 2.0M | |
![[IMG]](/icons/image2.gif) | steam10.jpg | 2019-09-20 09:40 | 2.5M | |
![[IMG]](/icons/image2.gif) | steam12.jpg | 2019-09-20 09:40 | 2.6M | |
![[IMG]](/icons/image2.gif) | steam13.jpg | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | steam14.jpg | 2019-09-20 09:40 | 3.5M | |
![[IMG]](/icons/image2.gif) | steamext1.jpg | 2019-09-20 09:40 | 3.2M | |
![[IMG]](/icons/image2.gif) | steamext2.jpg | 2019-09-20 09:40 | 3.1M | |
![[IMG]](/icons/image2.gif) | stressed-career-woman_400x295_80.jpg | 2019-09-20 09:40 | 25K | |
![[IMG]](/icons/image2.gif) | sttjuneraffle.jpg | 2019-09-20 09:40 | 105K | |
![[IMG]](/icons/image2.gif) | student-xxl.png | 2019-09-20 09:40 | 9.6K | |
![[IMG]](/icons/image2.gif) | tempvide.png | 2019-09-20 09:40 | 8.5K | |
![[IMG]](/icons/image2.gif) | thumbnail_20190506_080311-1.jpg | 2019-09-20 09:40 | 288K | |
![[IMG]](/icons/image2.gif) | thumbnail_20190506_080311.jpg | 2019-09-20 09:40 | 288K | |
![[DIR]](/icons/folder.gif) | thumbnails/ | 2019-09-20 09:37 | - | |
![[IMG]](/icons/image2.gif) | todmanHorz.jpg | 2019-09-20 09:40 | 110K | |
![[IMG]](/icons/image2.gif) | united-states-virgin-islands383.jpg | 2019-09-20 09:40 | 125K | |
![[IMG]](/icons/image2.gif) | unity1.jpg | 2019-09-20 09:40 | 484K | |
![[IMG]](/icons/image2.gif) | unity2.jpg | 2019-09-20 09:40 | 490K | |
![[IMG]](/icons/image2.gif) | unity3.jpg | 2019-09-20 09:40 | 756K | |
![[TXT]](/icons/text.gif) | untitled file.txt | 2019-09-20 09:40 | 0 | |
![[TXT]](/icons/text.gif) | untitled file 1.txt | 2019-09-20 09:40 | 0 | |
![[DIR]](/icons/folder.gif) | untitled folder 1/ | 2019-09-20 09:37 | - | |
![[DIR]](/icons/folder.gif) | users/ | 2019-11-18 14:07 | - | |
![[IMG]](/icons/image2.gif) | vNlsRbF.jpg | 2019-09-20 09:41 | 507K | |
![[IMG]](/icons/image2.gif) | vi-logo.png | 2019-09-20 09:41 | 132K | |
![[IMG]](/icons/image2.gif) | videlogo.png | 2019-09-20 09:41 | 35K | |
![[DIR]](/icons/folder.gif) | videnewsletter/ | 2019-09-20 09:39 | - | |
![[IMG]](/icons/image2.gif) | vi mathcounts winner.jpg | 2019-09-20 09:41 | 46K | |
![[IMG]](/icons/image2.gif) | woodsontooth.jpg | 2019-09-20 09:41 | 940K | |
![[IMG]](/icons/image2.gif) | youthwritesback.jpg | 2019-09-20 09:41 | 723K | |
|